C22H21N5O3 — CID 10621189
(2R,3S,4R,5R)-2-methyl-5-[5-phenyl-4-(pyridin-3-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol (PubChem CID 10621189) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-methyl-5-[5-phenyl-4-(pyridin-3-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-methyl-5-[5-phenyl-4-(pyridin-3-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 10621189 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (2R,3S,4R,5R)-2-methyl-5-[5-phenyl-4-(pyridin-3-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]oxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cc(-c3ccccc3)c3c(Nc4cccnc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H21N5O3/c1-13-18(28)19(29)22(30-13)27-11-16(14-6-3-2-4-7-14)17-20(24-12-25-21(17)27)26-15-8-5-9-23-10-15/h2-13,18-19,22,28-29H,1H3,(H,24,25,26)/t13-,18-,19-,22-/m1/s1 |
| InChIKey | FFBULMGRNCLAGN-ZYFHONAXSA-N |
| XLogP | 2.88 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |