C25H28N2O3 — CID 10621252
4-(1,7,7,10,10-pentamethyl-2-oxo-8,9-dihydro-3H-benzo[h][1,4]benzodiazepin-5-yl)benzoic acid (PubChem CID 10621252) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-(1,7,7,10,10-pentamethyl-2-oxo-8,9-dihydro-3H-benzo[h][1,4]benzodiazepin-5-yl)benzoic acid.
| Compound Name | 4-(1,7,7,10,10-pentamethyl-2-oxo-8,9-dihydro-3H-benzo[h][1,4]benzodiazepin-5-yl)benzoic acid |
|---|---|
| PubChem CID | 10621252 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 4-(1,7,7,10,10-pentamethyl-2-oxo-8,9-dihydro-3H-benzo[h][1,4]benzodiazepin-5-yl)benzoic acid |
| SMILES | CN1C(=O)CN=C(c2ccc(C(=O)O)cc2)c2cc3c(cc21)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C25H28N2O3/c1-24(2)10-11-25(3,4)19-13-20-17(12-18(19)24)22(26-14-21(28)27(20)5)15-6-8-16(9-7-15)23(29)30/h6-9,12-13H,10-11,14H2,1-5H3,(H,29,30) |
| InChIKey | MIPNSMBCJILFGD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |