C10H16N4O — CID 106212913
(2S)-N-[1-(1H-pyrazol-4-yl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 106212913) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is (2S)-N-[1-(1H-pyrazol-4-yl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[1-(1H-pyrazol-4-yl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106212913 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (2S)-N-[1-(1H-pyrazol-4-yl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(NC(=O)[C@@H]1CCCN1)c1cn[nH]c1 |
| InChI | InChI=1S/C10H16N4O/c1-7(8-5-12-13-6-8)14-10(15)9-3-2-4-11-9/h5-7,9,11H,2-4H2,1H3,(H,12,13)(H,14,15)/t7?,9-/m0/s1 |
| InChIKey | RIXKZSPTIYNRCZ-NETXQHHPSA-N |
| XLogP | 0.34 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |