C23H19NO4S — CID 10621302
(2R)-3-phenyl-2-[[4-(2-phenylethynyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 10621302) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is (2R)-3-phenyl-2-[[4-(2-phenylethynyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-3-phenyl-2-[[4-(2-phenylethynyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 10621302 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (2R)-3-phenyl-2-[[4-(2-phenylethynyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO4S/c25-23(26)22(17-20-9-5-2-6-10-20)24-29(27,28)21-15-13-19(14-16-21)12-11-18-7-3-1-4-8-18/h1-10,13-16,22,24H,17H2,(H,25,26)/t22-/m1/s1 |
| InChIKey | VFURABQMPHTDQE-JOCHJYFZSA-N |
| XLogP | 3.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|