C16H22N2O — CID 106213111
3-(4-aminophenyl)-N-hex-5-ynylbutanamide (PubChem CID 106213111) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-hex-5-ynylbutanamide.
| Compound Name | 3-(4-aminophenyl)-N-hex-5-ynylbutanamide |
|---|---|
| PubChem CID | 106213111 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-(4-aminophenyl)-N-hex-5-ynylbutanamide |
| SMILES | C#CCCCCNC(=O)CC(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H22N2O/c1-3-4-5-6-11-18-16(19)12-13(2)14-7-9-15(17)10-8-14/h1,7-10,13H,4-6,11-12,17H2,2H3,(H,18,19) |
| InChIKey | FGVNWOQIQJUZFR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|