About 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide
1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide (PubChem CID 106213269) has the molecular formula C13H21F3N2O2
and a molecular weight of 294.32 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide |
| PubChem CID | 106213269 |
| Molecular Formula | C13H21F3N2O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)NC2(C(F)(F)F)CC2)C1(C)C |
| InChI | InChI=1S/C13H21F3N2O2/c1-4-20-8-7-12(17,10(8,2)3)9(19)18-11(5-6-11)13(14,15)16/h8H,4-7,17H2,1-3H3,(H,18,19) |
| InChIKey | TTWXGNYPCRSCMF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide?
The IUPAC name of 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide (CID 106213269) is 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide.
What is the SMILES notation for 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide?
The canonical SMILES for 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide is CCOC1CC(N)(C(=O)NC2(C(F)(F)F)CC2)C1(C)C.
What is the InChIKey of 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide?
The InChIKey is TTWXGNYPCRSCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3N2O2/c1-4-20-8-7-12(17,10(8,2)3)9(19)18-11(5-6-11)13(14,15)16/h8H,4-7,17H2,1-3H3,(H,18,19).
What are the key properties of 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide?
1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide has a molecular weight of 294.32 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-ethoxy-2,2-dimethyl-N-[1-(trifluoromethyl)cyclopropyl]cyclobutane-1-carboxamide is sourced from PubChem (CID 106213269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).