C10H13F3N2O — CID 106213496
2-cyano-3-methyl-N-[1-(trifluoromethyl)cyclopropyl]butanamide (PubChem CID 106213496) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-cyano-3-methyl-N-[1-(trifluoromethyl)cyclopropyl]butanamide.
| Compound Name | 2-cyano-3-methyl-N-[1-(trifluoromethyl)cyclopropyl]butanamide |
|---|---|
| PubChem CID | 106213496 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-cyano-3-methyl-N-[1-(trifluoromethyl)cyclopropyl]butanamide |
| SMILES | CC(C)C(C#N)C(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F3N2O/c1-6(2)7(5-14)8(16)15-9(3-4-9)10(11,12)13/h6-7H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | COKPYFLRMFOIIV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |