About 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide (PubChem CID 10621353) has the molecular formula C20H26N2O5S
and a molecular weight of 406.50 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide |
| PubChem CID | 10621353 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)C(C(=O)NO)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-20(2,3)18(19(23)21-24)22(14-15-8-6-5-7-9-15)28(25,26)17-12-10-16(27-4)11-13-17/h5-13,18,24H,14H2,1-4H3,(H,21,23) |
| InChIKey | FPLZEJRPZZSIBP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide?
The IUPAC name of 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide (CID 10621353) is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide.
What is the SMILES notation for 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide?
The canonical SMILES for 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide is COc1ccc(S(=O)(=O)N(Cc2ccccc2)C(C(=O)NO)C(C)(C)C)cc1.
What is the InChIKey of 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide?
The InChIKey is FPLZEJRPZZSIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O5S/c1-20(2,3)18(19(23)21-24)22(14-15-8-6-5-7-9-15)28(25,26)17-12-10-16(27-4)11-13-17/h5-13,18,24H,14H2,1-4H3,(H,21,23).
What are the key properties of 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide?
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide has a molecular weight of 406.50 g/mol, XLogP of 2.81, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3,3-dimethylbutanamide is sourced from PubChem (CID 10621353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).