C11H7F6N3 — CID 106213558
6-(trifluoromethyl)-2-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-3-carbonitrile (PubChem CID 106213558) has the molecular formula C11H7F6N3 and a molecular weight of 295.19 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-(trifluoromethyl)-2-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 106213558 |
| Molecular Formula | C11H7F6N3 |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 6-(trifluoromethyl)-2-[[1-(trifluoromethyl)cyclopropyl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H7F6N3/c12-10(13,14)7-2-1-6(5-18)8(19-7)20-9(3-4-9)11(15,16)17/h1-2H,3-4H2,(H,19,20) |
| InChIKey | USQCOAWFFNBFQC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |