C23H25N3O4 — CID 10621389
2-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-5-methylisoindole-1,3-dione (PubChem CID 10621389) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-5-methylisoindole-1,3-dione.
| Compound Name | 2-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 10621389 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[2-[4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazin-1-yl]ethyl]-5-methylisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCN1CCN(c3cccc4c3OCCO4)CC1)C2=O |
| InChI | InChI=1S/C23H25N3O4/c1-16-5-6-17-18(15-16)23(28)26(22(17)27)12-9-24-7-10-25(11-8-24)19-3-2-4-20-21(19)30-14-13-29-20/h2-6,15H,7-14H2,1H3 |
| InChIKey | GMOXKGDOIHHIPZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|