C9H10F3N3S — CID 106215025
6-methylsulfanyl-N-[1-(trifluoromethyl)cyclopropyl]pyrimidin-4-amine (PubChem CID 106215025) has the molecular formula C9H10F3N3S and a molecular weight of 249.26 g/mol. Its IUPAC name is 6-methylsulfanyl-N-[1-(trifluoromethyl)cyclopropyl]pyrimidin-4-amine.
| Compound Name | 6-methylsulfanyl-N-[1-(trifluoromethyl)cyclopropyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106215025 |
| Molecular Formula | C9H10F3N3S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 6-methylsulfanyl-N-[1-(trifluoromethyl)cyclopropyl]pyrimidin-4-amine |
| SMILES | CSc1cc(NC2(C(F)(F)F)CC2)ncn1 |
| InChI | InChI=1S/C9H10F3N3S/c1-16-7-4-6(13-5-14-7)15-8(2-3-8)9(10,11)12/h4-5H,2-3H2,1H3,(H,13,14,15) |
| InChIKey | ATGIPNVRXPRFFR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |