About 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole
1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole (PubChem CID 10621562) has the molecular formula C20H17F4NO2S
and a molecular weight of 411.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole |
| PubChem CID | 10621562 |
| Molecular Formula | C20H17F4NO2S |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole |
| SMILES | Cc1c(CC(F)(F)F)cc(-c2ccc(S(C)(=O)=O)cc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17F4NO2S/c1-13-15(12-20(22,23)24)11-19(25(13)17-7-5-16(21)6-8-17)14-3-9-18(10-4-14)28(2,26)27/h3-11H,12H2,1-2H3 |
| InChIKey | KKKZOKQDFWCLMP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole?
The IUPAC name of 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole (CID 10621562) is 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole.
What is the SMILES notation for 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole?
The canonical SMILES for 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole is Cc1c(CC(F)(F)F)cc(-c2ccc(S(C)(=O)=O)cc2)n1-c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole?
The InChIKey is KKKZOKQDFWCLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F4NO2S/c1-13-15(12-20(22,23)24)11-19(25(13)17-7-5-16(21)6-8-17)14-3-9-18(10-4-14)28(2,26)27/h3-11H,12H2,1-2H3.
What are the key properties of 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole?
1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole has a molecular weight of 411.42 g/mol, XLogP of 5.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-2-methyl-5-(4-methylsulfonylphenyl)-3-(2,2,2-trifluoroethyl)pyrrole is sourced from PubChem (CID 10621562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).