About 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide
4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide (PubChem CID 106215834) has the molecular formula C10H13F3N4OS
and a molecular weight of 294.30 g/mol. Its IUPAC name is 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide |
| PubChem CID | 106215834 |
| Molecular Formula | C10H13F3N4OS |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide |
| SMILES | CN(C)c1nc(N)c(C(=O)NC2(C(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C10H13F3N4OS/c1-17(2)8-15-6(14)5(19-8)7(18)16-9(3-4-9)10(11,12)13/h3-4,14H2,1-2H3,(H,16,18) |
| InChIKey | GWEQBDGTGWFGKE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide (CID 106215834) is 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide is CN(C)c1nc(N)c(C(=O)NC2(C(F)(F)F)CC2)s1.
What is the InChIKey of 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide?
The InChIKey is GWEQBDGTGWFGKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N4OS/c1-17(2)8-15-6(14)5(19-8)7(18)16-9(3-4-9)10(11,12)13/h3-4,14H2,1-2H3,(H,16,18).
What are the key properties of 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide?
4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide has a molecular weight of 294.30 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(dimethylamino)-N-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 106215834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).