C17H27F3O4SSi — CID 10621631
[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl] 4-methylbenzenesulfonate (PubChem CID 10621631) has the molecular formula C17H27F3O4SSi and a molecular weight of 412.55 g/mol. Its IUPAC name is [(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl] 4-methylbenzenesulfonate.
| Compound Name | [(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10621631 |
| Molecular Formula | C17H27F3O4SSi |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H](O[Si](C)(C)C(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H27F3O4SSi/c1-13-7-9-14(10-8-13)25(21,22)23-12-11-15(17(18,19)20)24-26(5,6)16(2,3)4/h7-10,15H,11-12H2,1-6H3/t15-/m1/s1 |
| InChIKey | JCKYYXBYWLKFDK-OAHLLOKOSA-N |
| XLogP | 5.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|