C13H5F11N2O — CID 10621694
2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 10621694) has the molecular formula C13H5F11N2O and a molecular weight of 414.17 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 10621694 |
| Molecular Formula | C13H5F11N2O |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C13H5F11N2O/c14-9(15,6-5-8(27)26-4-2-1-3-7(26)25-6)10(16,17)11(18,19)12(20,21)13(22,23)24/h1-5H |
| InChIKey | OQGQIXMLVUOWLJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|