C14H13F3N2O2 — CID 106217017
2-ethyl-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole-5-carboxylic acid (PubChem CID 106217017) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-ethyl-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole-5-carboxylic acid.
| Compound Name | 2-ethyl-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 106217017 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-ethyl-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole-5-carboxylic acid |
| SMILES | CCc1nc2cc(C(=O)O)ccc2n1C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H13F3N2O2/c1-2-11-18-9-7-8(12(20)21)3-4-10(9)19(11)13(5-6-13)14(15,16)17/h3-4,7H,2,5-6H2,1H3,(H,20,21) |
| InChIKey | UYFBEIWAFMETNQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |