C19H26O10 — CID 10621703
[(1R,3R,4S,4aR,5S,7aS)-4,5-diacetyloxy-7-(acetyloxymethyl)-1-methoxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-3-yl]methyl acetate (PubChem CID 10621703) has the molecular formula C19H26O10 and a molecular weight of 414.41 g/mol. Its IUPAC name is [(1R,3R,4S,4aR,5S,7aS)-4,5-diacetyloxy-7-(acetyloxymethyl)-1-methoxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-3-yl]methyl acetate.
| Compound Name | [(1R,3R,4S,4aR,5S,7aS)-4,5-diacetyloxy-7-(acetyloxymethyl)-1-methoxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10621703 |
| Molecular Formula | C19H26O10 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(1R,3R,4S,4aR,5S,7aS)-4,5-diacetyloxy-7-(acetyloxymethyl)-1-methoxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-3-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]2[C@H]1C(COC(C)=O)=C[C@@H]2OC(C)=O |
| InChI | InChI=1S/C19H26O10/c1-9(20)25-7-13-6-14(27-11(3)22)17-16(13)19(24-5)29-15(8-26-10(2)21)18(17)28-12(4)23/h6,14-19H,7-8H2,1-5H3/t14-,15+,16+,17-,18+,19+/m0/s1 |
| InChIKey | JSUIOVAHQLASBS-SWAOIJHYSA-N |
| XLogP | 0.52 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|