About 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine
2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine (PubChem CID 106217314) has the molecular formula C13H12F3N3
and a molecular weight of 267.25 g/mol. Its IUPAC name is 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine.
Molecular Properties
| Compound Name | 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine |
| PubChem CID | 106217314 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine |
| SMILES | Nc1ccc2nc(NC3(C(F)(F)F)CC3)ccc2c1 |
| InChI | InChI=1S/C13H12F3N3/c14-13(15,16)12(5-6-12)19-11-4-1-8-7-9(17)2-3-10(8)18-11/h1-4,7H,5-6,17H2,(H,18,19) |
| InChIKey | WFHVNNCQMUMCBF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine?
The IUPAC name of 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine (CID 106217314) is 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine.
What is the SMILES notation for 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine?
The canonical SMILES for 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine is Nc1ccc2nc(NC3(C(F)(F)F)CC3)ccc2c1.
What is the InChIKey of 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine?
The InChIKey is WFHVNNCQMUMCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N3/c14-13(15,16)12(5-6-12)19-11-4-1-8-7-9(17)2-3-10(8)18-11/h1-4,7H,5-6,17H2,(H,18,19).
What are the key properties of 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine?
2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine has a molecular weight of 267.25 g/mol, XLogP of 3.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[1-(trifluoromethyl)cyclopropyl]quinoline-2,6-diamine is sourced from PubChem (CID 106217314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).