C8H15F3N2O2S — CID 106217437
1-amino-N-[1-(trifluoromethyl)cyclopropyl]butane-2-sulfonamide (PubChem CID 106217437) has the molecular formula C8H15F3N2O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 1-amino-N-[1-(trifluoromethyl)cyclopropyl]butane-2-sulfonamide.
| Compound Name | 1-amino-N-[1-(trifluoromethyl)cyclopropyl]butane-2-sulfonamide |
|---|---|
| PubChem CID | 106217437 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-amino-N-[1-(trifluoromethyl)cyclopropyl]butane-2-sulfonamide |
| SMILES | CCC(CN)S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H15F3N2O2S/c1-2-6(5-12)16(14,15)13-7(3-4-7)8(9,10)11/h6,13H,2-5,12H2,1H3 |
| InChIKey | UHRYXJKNYJVMQQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |