C20H25N5O3S — CID 10621792
(2R,3R,4S,5S)-2-[6-(benzylamino)purin-9-yl]-5-(propylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 10621792) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[6-(benzylamino)purin-9-yl]-5-(propylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[6-(benzylamino)purin-9-yl]-5-(propylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10621792 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2R,3R,4S,5S)-2-[6-(benzylamino)purin-9-yl]-5-(propylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | CCCSC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25N5O3S/c1-2-8-29-10-14-16(26)17(27)20(28-14)25-12-24-15-18(22-11-23-19(15)25)21-9-13-6-4-3-5-7-13/h3-7,11-12,14,16-17,20,26-27H,2,8-10H2,1H3,(H,21,22,23)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | SAIWICSBUHUKBF-WVSUBDOOSA-N |
| XLogP | 2.20 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|