C27H45NO2 — CID 10621802
2-[(1R,3aS,4R,5S,7aR)-5-(6-cyanohex-1-en-2-yl)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetic acid (PubChem CID 10621802) has the molecular formula C27H45NO2 and a molecular weight of 415.66 g/mol. Its IUPAC name is 2-[(1R,3aS,4R,5S,7aR)-5-(6-cyanohex-1-en-2-yl)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetic acid.
| Compound Name | 2-[(1R,3aS,4R,5S,7aR)-5-(6-cyanohex-1-en-2-yl)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetic acid |
|---|---|
| PubChem CID | 10621802 |
| Molecular Formula | C27H45NO2 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.35 |
| IUPAC Name | 2-[(1R,3aS,4R,5S,7aR)-5-(6-cyanohex-1-en-2-yl)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetic acid |
| SMILES | C=C(CCCCC#N)[C@H]1CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]2[C@@H]1CC(=O)O |
| InChI | InChI=1S/C27H45NO2/c1-19(2)10-9-12-21(4)24-13-14-25-23(18-26(29)30)22(15-16-27(24,25)5)20(3)11-7-6-8-17-28/h19,21-25H,3,6-16,18H2,1-2,4-5H3,(H,29,30)/t21-,22-,23-,24-,25+,27-/m1/s1 |
| InChIKey | ZJQXNLOWFDLQBG-NBMRGHAKSA-N |
| XLogP | 7.62 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|