About 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine
5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106219730) has the molecular formula C8H9ClF3N3O
and a molecular weight of 255.63 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine |
| PubChem CID | 106219730 |
| Molecular Formula | C8H9ClF3N3O |
| Molecular Weight | 255.63 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine |
| SMILES | FC(F)(F)C1(Nc2nnc(CCCl)o2)CC1 |
| InChI | InChI=1S/C8H9ClF3N3O/c9-4-1-5-14-15-6(16-5)13-7(2-3-7)8(10,11)12/h1-4H2,(H,13,15) |
| InChIKey | OMYOYIFJIFXTOO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.63 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine (CID 106219730) is 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine is FC(F)(F)C1(Nc2nnc(CCCl)o2)CC1.
What is the InChIKey of 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine?
The InChIKey is OMYOYIFJIFXTOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3N3O/c9-4-1-5-14-15-6(16-5)13-7(2-3-7)8(10,11)12/h1-4H2,(H,13,15).
What are the key properties of 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine?
5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine has a molecular weight of 255.63 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloroethyl)-N-[1-(trifluoromethyl)cyclopropyl]-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 106219730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).