About 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine
5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine (PubChem CID 106220282) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine.
Molecular Properties
| Compound Name | 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine |
| PubChem CID | 106220282 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine |
| SMILES | Cc1nn(C)c(C)c1C#CCCCN |
| InChI | InChI=1S/C11H17N3/c1-9-11(7-5-4-6-8-12)10(2)14(3)13-9/h4,6,8,12H2,1-3H3 |
| InChIKey | AXHHLYBQCYISLW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine?
The IUPAC name of 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine (CID 106220282) is 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine.
What is the SMILES notation for 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine?
The canonical SMILES for 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine is Cc1nn(C)c(C)c1C#CCCCN.
What is the InChIKey of 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine?
The InChIKey is AXHHLYBQCYISLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-9-11(7-5-4-6-8-12)10(2)14(3)13-9/h4,6,8,12H2,1-3H3.
What are the key properties of 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine?
5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine has a molecular weight of 191.28 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3,5-trimethylpyrazol-4-yl)pent-4-yn-1-amine is sourced from PubChem (CID 106220282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).