C13H15F3N4 — CID 106220554
3-[1-[4-methyl-3-(trifluoromethyl)phenyl]triazol-4-yl]propan-1-amine (PubChem CID 106220554) has the molecular formula C13H15F3N4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-[1-[4-methyl-3-(trifluoromethyl)phenyl]triazol-4-yl]propan-1-amine.
| Compound Name | 3-[1-[4-methyl-3-(trifluoromethyl)phenyl]triazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 106220554 |
| Molecular Formula | C13H15F3N4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-[1-[4-methyl-3-(trifluoromethyl)phenyl]triazol-4-yl]propan-1-amine |
| SMILES | Cc1ccc(-n2cc(CCCN)nn2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N4/c1-9-4-5-11(7-12(9)13(14,15)16)20-8-10(18-19-20)3-2-6-17/h4-5,7-8H,2-3,6,17H2,1H3 |
| InChIKey | PPNYEYBZOYCKSG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |