C26H34N2O3 — CID 10622156
(3aR,9bR)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole (PubChem CID 10622156) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is (3aR,9bR)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole.
| Compound Name | (3aR,9bR)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
|---|---|
| PubChem CID | 10622156 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (3aR,9bR)-2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
| SMILES | COc1cc2c(cc1OC)CN(CCN1C[C@@H]3CCc4c(OC)cccc4[C@@H]3C1)CC2 |
| InChI | InChI=1S/C26H34N2O3/c1-29-24-6-4-5-21-22(24)8-7-19-15-28(17-23(19)21)12-11-27-10-9-18-13-25(30-2)26(31-3)14-20(18)16-27/h4-6,13-14,19,23H,7-12,15-17H2,1-3H3/t19-,23+/m0/s1 |
| InChIKey | WKPITOGUWYLINO-WMZHIEFXSA-N |
| XLogP | 3.73 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |