About 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane
11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane (PubChem CID 106222076) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane |
| PubChem CID | 106222076 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane |
| SMILES | C#CCCCN1CCCNC2(CCCCC2)C1 |
| InChI | InChI=1S/C15H26N2/c1-2-3-7-12-17-13-8-11-16-15(14-17)9-5-4-6-10-15/h1,16H,3-14H2 |
| InChIKey | NHUVLHBUBGYAEZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane?
The IUPAC name of 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane (CID 106222076) is 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane.
What is the SMILES notation for 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane?
The canonical SMILES for 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane is C#CCCCN1CCCNC2(CCCCC2)C1.
What is the InChIKey of 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane?
The InChIKey is NHUVLHBUBGYAEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2/c1-2-3-7-12-17-13-8-11-16-15(14-17)9-5-4-6-10-15/h1,16H,3-14H2.
What are the key properties of 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane?
11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane has a molecular weight of 234.39 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-pent-4-ynyl-7,11-diazaspiro[5.6]dodecane is sourced from PubChem (CID 106222076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).