C22H20N2O5S — CID 10622237
4-methoxy-N-[2-[(4-methylsulfonylbenzoyl)amino]phenyl]benzamide (PubChem CID 10622237) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-methoxy-N-[2-[(4-methylsulfonylbenzoyl)amino]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[(4-methylsulfonylbenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 10622237 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-methoxy-N-[2-[(4-methylsulfonylbenzoyl)amino]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2NC(=O)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O5S/c1-29-17-11-7-15(8-12-17)21(25)23-19-5-3-4-6-20(19)24-22(26)16-9-13-18(14-10-16)30(2,27)28/h3-14H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | OIBQOEQWAYXQGP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |