C13H19NO3 — CID 106223186
4-(pent-4-ynylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 106223186) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-(pent-4-ynylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(pent-4-ynylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106223186 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-(pent-4-ynylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | C#CCCCNC(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H19NO3/c1-2-3-4-9-14-12(15)10-5-7-11(8-6-10)13(16)17/h1,10-11H,3-9H2,(H,14,15)(H,16,17) |
| InChIKey | TXVOQLJCOHGLSZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|