C12H12F2N2O — CID 106224117
1-[3-(3,5-difluorophenyl)-1,2-oxazol-5-yl]propan-1-amine (PubChem CID 106224117) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is 1-[3-(3,5-difluorophenyl)-1,2-oxazol-5-yl]propan-1-amine.
| Compound Name | 1-[3-(3,5-difluorophenyl)-1,2-oxazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 106224117 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-[3-(3,5-difluorophenyl)-1,2-oxazol-5-yl]propan-1-amine |
| SMILES | CCC(N)c1cc(-c2cc(F)cc(F)c2)no1 |
| InChI | InChI=1S/C12H12F2N2O/c1-2-10(15)12-6-11(16-17-12)7-3-8(13)5-9(14)4-7/h3-6,10H,2,15H2,1H3 |
| InChIKey | UXBYYHRVALYUFK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |