C11H20N2O — CID 106224130
1-(3-butyl-1,2-oxazol-5-yl)butan-1-amine (PubChem CID 106224130) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(3-butyl-1,2-oxazol-5-yl)butan-1-amine.
| Compound Name | 1-(3-butyl-1,2-oxazol-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 106224130 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(3-butyl-1,2-oxazol-5-yl)butan-1-amine |
| SMILES | CCCCc1cc(C(N)CCC)on1 |
| InChI | InChI=1S/C11H20N2O/c1-3-5-7-9-8-11(14-13-9)10(12)6-4-2/h8,10H,3-7,12H2,1-2H3 |
| InChIKey | PTZKMBGOZXSDCK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |