C19H28N2 — CID 106224606
1-hex-1-yn-3-yl-2-phenyl-5-propan-2-ylpiperazine (PubChem CID 106224606) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-hex-1-yn-3-yl-2-phenyl-5-propan-2-ylpiperazine.
| Compound Name | 1-hex-1-yn-3-yl-2-phenyl-5-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 106224606 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 1-hex-1-yn-3-yl-2-phenyl-5-propan-2-ylpiperazine |
| SMILES | C#CC(CCC)N1CC(C(C)C)NCC1c1ccccc1 |
| InChI | InChI=1S/C19H28N2/c1-5-10-17(6-2)21-14-18(15(3)4)20-13-19(21)16-11-8-7-9-12-16/h2,7-9,11-12,15,17-20H,5,10,13-14H2,1,3-4H3 |
| InChIKey | BYGXQEMXVLKDPM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|