C23H44O5Si — CID 10622465
(Z)-9-[tert-butyl(dimethyl)silyl]oxy-12-(2,2-dimethyl-1,3-dioxolan-4-yl)dodec-11-enoic acid (PubChem CID 10622465) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is (Z)-9-[tert-butyl(dimethyl)silyl]oxy-12-(2,2-dimethyl-1,3-dioxolan-4-yl)dodec-11-enoic acid.
| Compound Name | (Z)-9-[tert-butyl(dimethyl)silyl]oxy-12-(2,2-dimethyl-1,3-dioxolan-4-yl)dodec-11-enoic acid |
|---|---|
| PubChem CID | 10622465 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | (Z)-9-[tert-butyl(dimethyl)silyl]oxy-12-(2,2-dimethyl-1,3-dioxolan-4-yl)dodec-11-enoic acid |
| SMILES | CC1(C)OCC(/C=C\CC(CCCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H44O5Si/c1-22(2,3)29(6,7)28-19(14-11-9-8-10-12-17-21(24)25)15-13-16-20-18-26-23(4,5)27-20/h13,16,19-20H,8-12,14-15,17-18H2,1-7H3,(H,24,25)/b16-13- |
| InChIKey | MYVFMDBECYOGCJ-SSZFMOIBSA-N |
| XLogP | 6.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|