C14H24N2 — CID 106224689
3-cyclopropyl-1-hex-1-yn-3-yl-3-methylpiperazine (PubChem CID 106224689) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 3-cyclopropyl-1-hex-1-yn-3-yl-3-methylpiperazine.
| Compound Name | 3-cyclopropyl-1-hex-1-yn-3-yl-3-methylpiperazine |
|---|---|
| PubChem CID | 106224689 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 3-cyclopropyl-1-hex-1-yn-3-yl-3-methylpiperazine |
| SMILES | C#CC(CCC)N1CCNC(C)(C2CC2)C1 |
| InChI | InChI=1S/C14H24N2/c1-4-6-13(5-2)16-10-9-15-14(3,11-16)12-7-8-12/h2,12-13,15H,4,6-11H2,1,3H3 |
| InChIKey | OKSDPTICZGFPGU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|