About (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate
(5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate (PubChem CID 10622481) has the molecular formula C26H23NO5
and a molecular weight of 429.47 g/mol. Its IUPAC name is (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate.
Molecular Properties
| Compound Name | (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate |
| PubChem CID | 10622481 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate |
| SMILES | COC1=CC(=O)c2c(c(COC(=O)Cc3ccc(-c4ccccc4)cc3)c(C)n2C)C1=O |
| InChI | InChI=1S/C26H23NO5/c1-16-20(24-25(27(16)2)21(28)14-22(31-3)26(24)30)15-32-23(29)13-17-9-11-19(12-10-17)18-7-5-4-6-8-18/h4-12,14H,13,15H2,1-3H3 |
| InChIKey | YMODUSVJCJOSEK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate?
The IUPAC name of (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate (CID 10622481) is (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate.
What is the SMILES notation for (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate?
The canonical SMILES for (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate is COC1=CC(=O)c2c(c(COC(=O)Cc3ccc(-c4ccccc4)cc3)c(C)n2C)C1=O.
What is the InChIKey of (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate?
The InChIKey is YMODUSVJCJOSEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO5/c1-16-20(24-25(27(16)2)21(28)14-22(31-3)26(24)30)15-32-23(29)13-17-9-11-19(12-10-17)18-7-5-4-6-8-18/h4-12,14H,13,15H2,1-3H3.
What are the key properties of (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate?
(5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate has a molecular weight of 429.47 g/mol, XLogP of 4.20, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-1,2-dimethyl-4,7-dioxoindol-3-yl)methyl 2-(4-phenylphenyl)acetate is sourced from PubChem (CID 10622481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).