C11H17NO2 — CID 106225166
methyl 1-hex-1-yn-3-ylazetidine-2-carboxylate (PubChem CID 106225166) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is methyl 1-hex-1-yn-3-ylazetidine-2-carboxylate.
| Compound Name | methyl 1-hex-1-yn-3-ylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 106225166 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | methyl 1-hex-1-yn-3-ylazetidine-2-carboxylate |
| SMILES | C#CC(CCC)N1CCC1C(=O)OC |
| InChI | InChI=1S/C11H17NO2/c1-4-6-9(5-2)12-8-7-10(12)11(13)14-3/h2,9-10H,4,6-8H2,1,3H3 |
| InChIKey | YQFZPRWAJVFVKY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|