C13H23NO — CID 106225278
2,2,5,5-tetramethyl-N-pent-1-yn-3-yloxolan-3-amine (PubChem CID 106225278) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-pent-1-yn-3-yloxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-pent-1-yn-3-yloxolan-3-amine |
|---|---|
| PubChem CID | 106225278 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-pent-1-yn-3-yloxolan-3-amine |
| SMILES | C#CC(CC)NC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H23NO/c1-7-10(8-2)14-11-9-12(3,4)15-13(11,5)6/h1,10-11,14H,8-9H2,2-6H3 |
| InChIKey | ODAIICWAWYGDHP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|