C22H38O8 — CID 10622532
diethyl 2-[[(4R,5R)-4,5-bis(2-methoxypropan-2-yl)-1,3-dioxolan-2-yl]methyl]-2-prop-2-enylpropanedioate (PubChem CID 10622532) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is diethyl 2-[[(4R,5R)-4,5-bis(2-methoxypropan-2-yl)-1,3-dioxolan-2-yl]methyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[[(4R,5R)-4,5-bis(2-methoxypropan-2-yl)-1,3-dioxolan-2-yl]methyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 10622532 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | diethyl 2-[[(4R,5R)-4,5-bis(2-methoxypropan-2-yl)-1,3-dioxolan-2-yl]methyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(CC1O[C@@H](C(C)(C)OC)[C@H](C(C)(C)OC)O1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C22H38O8/c1-10-13-22(18(23)27-11-2,19(24)28-12-3)14-15-29-16(20(4,5)25-8)17(30-15)21(6,7)26-9/h10,15-17H,1,11-14H2,2-9H3/t16-,17-/m1/s1 |
| InChIKey | JAQJBOXFBVBVQL-IAGOWNOFSA-N |
| XLogP | 3.03 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|