C16H23NO — CID 106226015
N-[1-(2-ethoxyphenyl)ethyl]hex-1-yn-3-amine (PubChem CID 106226015) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is N-[1-(2-ethoxyphenyl)ethyl]hex-1-yn-3-amine.
| Compound Name | N-[1-(2-ethoxyphenyl)ethyl]hex-1-yn-3-amine |
|---|---|
| PubChem CID | 106226015 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-[1-(2-ethoxyphenyl)ethyl]hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NC(C)c1ccccc1OCC |
| InChI | InChI=1S/C16H23NO/c1-5-10-14(6-2)17-13(4)15-11-8-9-12-16(15)18-7-3/h2,8-9,11-14,17H,5,7,10H2,1,3-4H3 |
| InChIKey | UFQZUDMQAAHIJO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|