C20H20N2O7S — CID 10622602
(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 4-(phenylmethoxycarbonylamino)butanoate (PubChem CID 10622602) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 4-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 4-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 10622602 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 4-(phenylmethoxycarbonylamino)butanoate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)OCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C20H20N2O7S/c23-18(11-6-12-21-20(25)28-13-15-7-2-1-3-8-15)29-14-22-19(24)16-9-4-5-10-17(16)30(22,26)27/h1-5,7-10H,6,11-14H2,(H,21,25) |
| InChIKey | HEZYHVJSUKHORA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|