C18H19N — CID 106226453
1-(1,2-dihydroacenaphthylen-5-yl)hex-1-yn-3-amine (PubChem CID 106226453) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)hex-1-yn-3-amine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)hex-1-yn-3-amine |
|---|---|
| PubChem CID | 106226453 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)hex-1-yn-3-amine |
| SMILES | CCCC(N)C#Cc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C18H19N/c1-2-4-16(19)12-11-13-7-8-15-10-9-14-5-3-6-17(13)18(14)15/h3,5-8,16H,2,4,9-10,19H2,1H3 |
| InChIKey | COYOQQBHYYEGFC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|