About 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine
1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine (PubChem CID 106226464) has the molecular formula C13H16FN
and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine.
Molecular Properties
| Compound Name | 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine |
| PubChem CID | 106226464 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine |
| SMILES | CCC(N)C#Cc1c(C)cc(F)cc1C |
| InChI | InChI=1S/C13H16FN/c1-4-12(15)5-6-13-9(2)7-11(14)8-10(13)3/h7-8,12H,4,15H2,1-3H3 |
| InChIKey | JGERJZGCJBVTLM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine?
The IUPAC name of 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine (CID 106226464) is 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine.
What is the SMILES notation for 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine?
The canonical SMILES for 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine is CCC(N)C#Cc1c(C)cc(F)cc1C.
What is the InChIKey of 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine?
The InChIKey is JGERJZGCJBVTLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FN/c1-4-12(15)5-6-13-9(2)7-11(14)8-10(13)3/h7-8,12H,4,15H2,1-3H3.
What are the key properties of 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine?
1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine has a molecular weight of 205.28 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-2,6-dimethylphenyl)pent-1-yn-3-amine is sourced from PubChem (CID 106226464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).