About 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one
4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one (PubChem CID 106226592) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one |
| PubChem CID | 106226592 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one |
| SMILES | C#CC(CCC)n1cn[nH]c1=O |
| InChI | InChI=1S/C8H11N3O/c1-3-5-7(4-2)11-6-9-10-8(11)12/h2,6-7H,3,5H2,1H3,(H,10,12) |
| InChIKey | KPKMSIBGJREUFH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one (CID 106226592) is 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one is C#CC(CCC)n1cn[nH]c1=O.
What is the InChIKey of 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one?
The InChIKey is KPKMSIBGJREUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O/c1-3-5-7(4-2)11-6-9-10-8(11)12/h2,6-7H,3,5H2,1H3,(H,10,12).
What are the key properties of 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one?
4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one has a molecular weight of 165.20 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 106226592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).