C11H11Cl3N4 — CID 106226938
1-[1-(2,4,5-trichlorophenyl)triazol-4-yl]propan-1-amine (PubChem CID 106226938) has the molecular formula C11H11Cl3N4 and a molecular weight of 305.60 g/mol. Its IUPAC name is 1-[1-(2,4,5-trichlorophenyl)triazol-4-yl]propan-1-amine.
| Compound Name | 1-[1-(2,4,5-trichlorophenyl)triazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 106226938 |
| Molecular Formula | C11H11Cl3N4 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 1-[1-(2,4,5-trichlorophenyl)triazol-4-yl]propan-1-amine |
| SMILES | CCC(N)c1cn(-c2cc(Cl)c(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C11H11Cl3N4/c1-2-9(15)10-5-18(17-16-10)11-4-7(13)6(12)3-8(11)14/h3-5,9H,2,15H2,1H3 |
| InChIKey | HOWCCOLNARQCPY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|