C15H19NO2S — CID 106227284
N-hex-1-yn-3-yl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 106227284) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-hex-1-yn-3-yl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 106227284 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-hex-1-yn-3-yl-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | C#CC(CCC)NC1CCS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H19NO2S/c1-3-7-12(4-2)16-14-10-11-19(17,18)15-9-6-5-8-13(14)15/h2,5-6,8-9,12,14,16H,3,7,10-11H2,1H3 |
| InChIKey | GMVXPXHCPZBBRX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|