C17H19NS — CID 106227304
N-[(4-phenylthiophen-2-yl)methyl]hex-1-yn-3-amine (PubChem CID 106227304) has the molecular formula C17H19NS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-[(4-phenylthiophen-2-yl)methyl]hex-1-yn-3-amine.
| Compound Name | N-[(4-phenylthiophen-2-yl)methyl]hex-1-yn-3-amine |
|---|---|
| PubChem CID | 106227304 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[(4-phenylthiophen-2-yl)methyl]hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NCc1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H19NS/c1-3-8-16(4-2)18-12-17-11-15(13-19-17)14-9-6-5-7-10-14/h2,5-7,9-11,13,16,18H,3,8,12H2,1H3 |
| InChIKey | CIWHYEDVODLGTB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|