C10H17NO2 — CID 106227356
2-(hex-1-yn-3-ylamino)butanoic acid (PubChem CID 106227356) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(hex-1-yn-3-ylamino)butanoic acid.
| Compound Name | 2-(hex-1-yn-3-ylamino)butanoic acid |
|---|---|
| PubChem CID | 106227356 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-(hex-1-yn-3-ylamino)butanoic acid |
| SMILES | C#CC(CCC)NC(CC)C(=O)O |
| InChI | InChI=1S/C10H17NO2/c1-4-7-8(5-2)11-9(6-3)10(12)13/h2,8-9,11H,4,6-7H2,1,3H3,(H,12,13) |
| InChIKey | ZCBUVOHJFLINCY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|