C13H23F3N2 — CID 106227969
6,6,6-trifluoro-2-N-hex-1-yn-3-yl-2-methylhexane-1,2-diamine (PubChem CID 106227969) has the molecular formula C13H23F3N2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-N-hex-1-yn-3-yl-2-methylhexane-1,2-diamine.
| Compound Name | 6,6,6-trifluoro-2-N-hex-1-yn-3-yl-2-methylhexane-1,2-diamine |
|---|---|
| PubChem CID | 106227969 |
| Molecular Formula | C13H23F3N2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 6,6,6-trifluoro-2-N-hex-1-yn-3-yl-2-methylhexane-1,2-diamine |
| SMILES | C#CC(CCC)NC(C)(CN)CCCC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2/c1-4-7-11(5-2)18-12(3,10-17)8-6-9-13(14,15)16/h2,11,18H,4,6-10,17H2,1,3H3 |
| InChIKey | OBYWQXVLAGJMRG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|