C12H22N2 — CID 106227974
1-(aminomethyl)-N-hex-1-yn-3-yl-3-methylcyclobutan-1-amine (PubChem CID 106227974) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-(aminomethyl)-N-hex-1-yn-3-yl-3-methylcyclobutan-1-amine.
| Compound Name | 1-(aminomethyl)-N-hex-1-yn-3-yl-3-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 106227974 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-(aminomethyl)-N-hex-1-yn-3-yl-3-methylcyclobutan-1-amine |
| SMILES | C#CC(CCC)NC1(CN)CC(C)C1 |
| InChI | InChI=1S/C12H22N2/c1-4-6-11(5-2)14-12(9-13)7-10(3)8-12/h2,10-11,14H,4,6-9,13H2,1,3H3 |
| InChIKey | WMXFNDJEGVIPPF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|