About N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine
N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine (PubChem CID 106228042) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine |
| PubChem CID | 106228042 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine |
| SMILES | C#CC(CCC)NC(CN)c1ccc(C2CC2C)o1 |
| InChI | InChI=1S/C16H24N2O/c1-4-6-12(5-2)18-14(10-17)16-8-7-15(19-16)13-9-11(13)3/h2,7-8,11-14,18H,4,6,9-10,17H2,1,3H3 |
| InChIKey | JCHRZQOKUZEEKN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine?
The IUPAC name of N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine (CID 106228042) is N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine.
What is the SMILES notation for N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine?
The canonical SMILES for N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine is C#CC(CCC)NC(CN)c1ccc(C2CC2C)o1.
What is the InChIKey of N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine?
The InChIKey is JCHRZQOKUZEEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-4-6-12(5-2)18-14(10-17)16-8-7-15(19-16)13-9-11(13)3/h2,7-8,11-14,18H,4,6,9-10,17H2,1,3H3.
What are the key properties of N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine?
N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine has a molecular weight of 260.38 g/mol, XLogP of 2.79, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hex-1-yn-3-yl-1-[5-(2-methylcyclopropyl)furan-2-yl]ethane-1,2-diamine is sourced from PubChem (CID 106228042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).