C15H21BrN2O4S2 — CID 10622822
(3S)-4-(4-bromo-2-methylphenyl)sulfonyl-N-hydroxy-2,2-dimethyl-1,4-thiazepane-3-carboxamide (PubChem CID 10622822) has the molecular formula C15H21BrN2O4S2 and a molecular weight of 437.38 g/mol. Its IUPAC name is (3S)-4-(4-bromo-2-methylphenyl)sulfonyl-N-hydroxy-2,2-dimethyl-1,4-thiazepane-3-carboxamide.
| Compound Name | (3S)-4-(4-bromo-2-methylphenyl)sulfonyl-N-hydroxy-2,2-dimethyl-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 10622822 |
| Molecular Formula | C15H21BrN2O4S2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | (3S)-4-(4-bromo-2-methylphenyl)sulfonyl-N-hydroxy-2,2-dimethyl-1,4-thiazepane-3-carboxamide |
| SMILES | Cc1cc(Br)ccc1S(=O)(=O)N1CCCSC(C)(C)[C@@H]1C(=O)NO |
| InChI | InChI=1S/C15H21BrN2O4S2/c1-10-9-11(16)5-6-12(10)24(21,22)18-7-4-8-23-15(2,3)13(18)14(19)17-20/h5-6,9,13,20H,4,7-8H2,1-3H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | YTCCTPYUECNUFO-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|